About diethylalumanylium;octadecanoate
diethylalumanylium;octadecanoate (PubChem CID 22480669) has the molecular formula C22H45AlO2
and a molecular weight of 368.58 g/mol. Its IUPAC name is diethylalumanylium;octadecanoate.
Molecular Properties
| Compound Name | diethylalumanylium;octadecanoate |
| PubChem CID | 22480669 |
| Molecular Formula | C22H45AlO2 |
| Molecular Weight | 368.58 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | diethylalumanylium;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CC[Al+]CC |
| InChI | InChI=1S/C18H36O2.2C2H5.Al/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-2;/h2-17H2,1H3,(H,19,20);2*1H2,2H3;/q;;;+1/p-1 |
| InChIKey | CCOCQIOIKQPQSR-UHFFFAOYSA-M |
| XLogP | 6.56 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethylalumanylium;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylalumanylium;octadecanoate?
The IUPAC name of diethylalumanylium;octadecanoate (CID 22480669) is diethylalumanylium;octadecanoate.
What is the SMILES notation for diethylalumanylium;octadecanoate?
The canonical SMILES for diethylalumanylium;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].CC[Al+]CC.
What is the InChIKey of diethylalumanylium;octadecanoate?
The InChIKey is CCOCQIOIKQPQSR-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.2C2H5.Al/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-2;/h2-17H2,1H3,(H,19,20);2*1H2,2H3;/q;;;+1/p-1.
What are the key properties of diethylalumanylium;octadecanoate?
diethylalumanylium;octadecanoate has a molecular weight of 368.58 g/mol, XLogP of 6.56, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethylalumanylium;octadecanoate is sourced from PubChem (CID 22480669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).