About (Z)-tetradec-9-enoate
(Z)-tetradec-9-enoate (PubChem CID 5461014) has the molecular formula C14H25O2-
and a molecular weight of 225.35 g/mol. Its IUPAC name is (Z)-tetradec-9-enoate.
Molecular Properties
| Compound Name | (Z)-tetradec-9-enoate |
| PubChem CID | 5461014 |
| Molecular Formula | C14H25O2- |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (Z)-tetradec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/p-1/b6-5- |
| InChIKey | YWWVWXASSLXJHU-WAYWQWQTSA-M |
| XLogP | 3.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-tetradec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-tetradec-9-enoate?
The IUPAC name of (Z)-tetradec-9-enoate (CID 5461014) is (Z)-tetradec-9-enoate.
What is the SMILES notation for (Z)-tetradec-9-enoate?
The canonical SMILES for (Z)-tetradec-9-enoate is CCCC/C=C\CCCCCCCC(=O)[O-].
What is the InChIKey of (Z)-tetradec-9-enoate?
The InChIKey is YWWVWXASSLXJHU-WAYWQWQTSA-M. The full InChI is InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/p-1/b6-5-.
What are the key properties of (Z)-tetradec-9-enoate?
(Z)-tetradec-9-enoate has a molecular weight of 225.35 g/mol, XLogP of 3.21, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-tetradec-9-enoate is sourced from PubChem (CID 5461014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).