About (E)-octadec-13-enoate
(E)-octadec-13-enoate (PubChem CID 19042742) has the molecular formula C18H33O2-
and a molecular weight of 281.46 g/mol. Its IUPAC name is (E)-octadec-13-enoate.
Molecular Properties
| Compound Name | (E)-octadec-13-enoate |
| PubChem CID | 19042742 |
| Molecular Formula | C18H33O2- |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | (E)-octadec-13-enoate |
| SMILES | CCCC/C=C/CCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-6H,2-4,7-17H2,1H3,(H,19,20)/p-1/b6-5+ |
| InChIKey | BDLLSHRIFPDGQB-AATRIKPKSA-M |
| XLogP | 4.77 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-octadec-13-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-octadec-13-enoate?
The IUPAC name of (E)-octadec-13-enoate (CID 19042742) is (E)-octadec-13-enoate.
What is the SMILES notation for (E)-octadec-13-enoate?
The canonical SMILES for (E)-octadec-13-enoate is CCCC/C=C/CCCCCCCCCCCC(=O)[O-].
What is the InChIKey of (E)-octadec-13-enoate?
The InChIKey is BDLLSHRIFPDGQB-AATRIKPKSA-M. The full InChI is InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-6H,2-4,7-17H2,1H3,(H,19,20)/p-1/b6-5+.
What are the key properties of (E)-octadec-13-enoate?
(E)-octadec-13-enoate has a molecular weight of 281.46 g/mol, XLogP of 4.77, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-octadec-13-enoate is sourced from PubChem (CID 19042742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).