C20H35O2- — CID 57350570
icosa-5,15-dienoate (PubChem CID 57350570) has the molecular formula C20H35O2- and a molecular weight of 307.50 g/mol. Its IUPAC name is icosa-5,15-dienoate.
| Compound Name | icosa-5,15-dienoate |
|---|---|
| PubChem CID | 57350570 |
| Molecular Formula | C20H35O2- |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | icosa-5,15-dienoate |
| SMILES | CCCCC=CCCCCCCCCC=CCCCC(=O)[O-] |
| InChI | InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h5-6,15-16H,2-4,7-14,17-19H2,1H3,(H,21,22)/p-1 |
| InChIKey | WNCXYEKUZJPVOH-UHFFFAOYSA-M |
| XLogP | 5.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|