C9H12K2O8 — CID 158109252
dipotassium;4-hydroxy-4-oxobutanoate;5-hydroxy-5-oxopentanoate (PubChem CID 158109252) has the molecular formula C9H12K2O8 and a molecular weight of 326.38 g/mol. Its IUPAC name is dipotassium;4-hydroxy-4-oxobutanoate;5-hydroxy-5-oxopentanoate.
| Compound Name | dipotassium;4-hydroxy-4-oxobutanoate;5-hydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 158109252 |
| Molecular Formula | C9H12K2O8 |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | dipotassium;4-hydroxy-4-oxobutanoate;5-hydroxy-5-oxopentanoate |
| SMILES | O=C([O-])CCC(=O)O.O=C([O-])CCCC(=O)O.[K+].[K+] |
| InChI | InChI=1S/C5H8O4.C4H6O4.2K/c6-4(7)2-1-3-5(8)9;5-3(6)1-2-4(7)8;;/h1-3H2,(H,6,7)(H,8,9);1-2H2,(H,5,6)(H,7,8);;/q;;2*+1/p-2 |
| InChIKey | SMJRTCUVWKYHPK-UHFFFAOYSA-L |
| XLogP | -8.40 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | -8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |