C10H18F2O3 — CID 103147041
1-(2,2-difluoroethoxy)-6-methoxy-4-methylhexan-3-one (PubChem CID 103147041) has the molecular formula C10H18F2O3 and a molecular weight of 224.25 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-6-methoxy-4-methylhexan-3-one.
| Compound Name | 1-(2,2-difluoroethoxy)-6-methoxy-4-methylhexan-3-one |
|---|---|
| PubChem CID | 103147041 |
| Molecular Formula | C10H18F2O3 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-6-methoxy-4-methylhexan-3-one |
| SMILES | COCCC(C)C(=O)CCOCC(F)F |
| InChI | InChI=1S/C10H18F2O3/c1-8(3-5-14-2)9(13)4-6-15-7-10(11)12/h8,10H,3-7H2,1-2H3 |
| InChIKey | YDKWOJXQBDOENP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|