C12H18F2O6 — CID 103150185
diethyl 2-[3-(2,2-difluoroethoxy)propanoyl]propanedioate (PubChem CID 103150185) has the molecular formula C12H18F2O6 and a molecular weight of 296.27 g/mol. Its IUPAC name is diethyl 2-[3-(2,2-difluoroethoxy)propanoyl]propanedioate.
| Compound Name | diethyl 2-[3-(2,2-difluoroethoxy)propanoyl]propanedioate |
|---|---|
| PubChem CID | 103150185 |
| Molecular Formula | C12H18F2O6 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | diethyl 2-[3-(2,2-difluoroethoxy)propanoyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)CCOCC(F)F)C(=O)OCC |
| InChI | InChI=1S/C12H18F2O6/c1-3-19-11(16)10(12(17)20-4-2)8(15)5-6-18-7-9(13)14/h9-10H,3-7H2,1-2H3 |
| InChIKey | KDTTUESPRSJOSL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|