C8H16F2N2O — CID 103150890
3-(2,2-difluoroethoxy)-N'-propylpropanimidamide (PubChem CID 103150890) has the molecular formula C8H16F2N2O and a molecular weight of 194.22 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N'-propylpropanimidamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N'-propylpropanimidamide |
|---|---|
| PubChem CID | 103150890 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N'-propylpropanimidamide |
| SMILES | CCC/N=C(/N)CCOCC(F)F |
| InChI | InChI=1S/C8H16F2N2O/c1-2-4-12-8(11)3-5-13-6-7(9)10/h7H,2-6H2,1H3,(H2,11,12) |
| InChIKey | RBTGXNNZMZZOBC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|