C11H24N2O — CID 116732335
2-ethoxy-3,3-dimethyl-N'-propylbutanimidamide (PubChem CID 116732335) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-N'-propylbutanimidamide.
| Compound Name | 2-ethoxy-3,3-dimethyl-N'-propylbutanimidamide |
|---|---|
| PubChem CID | 116732335 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-N'-propylbutanimidamide |
| SMILES | CCC/N=C(\N)C(OCC)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O/c1-6-8-13-10(12)9(14-7-2)11(3,4)5/h9H,6-8H2,1-5H3,(H2,12,13) |
| InChIKey | FTMWOYSJIQDAJR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|