C15H28O2 — CID 116710014
2-ethoxy-3,3-dimethyl-1-(4-methylcyclohexyl)butan-1-one (PubChem CID 116710014) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-(4-methylcyclohexyl)butan-1-one.
| Compound Name | 2-ethoxy-3,3-dimethyl-1-(4-methylcyclohexyl)butan-1-one |
|---|---|
| PubChem CID | 116710014 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-(4-methylcyclohexyl)butan-1-one |
| SMILES | CCOC(C(=O)C1CCC(C)CC1)C(C)(C)C |
| InChI | InChI=1S/C15H28O2/c1-6-17-14(15(3,4)5)13(16)12-9-7-11(2)8-10-12/h11-12,14H,6-10H2,1-5H3 |
| InChIKey | SFLKWGDUTWGZFI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |