C12H18F2O3 — CID 62394136
ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate (PubChem CID 62394136) has the molecular formula C12H18F2O3 and a molecular weight of 248.27 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate.
| Compound Name | ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 62394136 |
| Molecular Formula | C12H18F2O3 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C12H18F2O3/c1-3-17-11(16)12(13,14)10(15)9-6-4-8(2)5-7-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | LAJLCNXTMJJXLQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|