ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate

C12H18F2O3 — CID 62394136

IUPACethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate
SMILESCCOC(=O)C(F)(F)C(=O)C1CCC(C)CC1
InChIInChI=1S/C12H18F2O3/c1-3-17-11(16)12(13,14)10(15)9-6-4-8(2)5-7-9/h8-9H,3-7H2,1-2H3
InChIKeyLAJLCNXTMJJXLQ-UHFFFAOYSA-N
MW248.27 g/mol
LogP2.58
Rot. Bonds4

About ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate

ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate (PubChem CID 62394136) has the molecular formula C12H18F2O3 and a molecular weight of 248.27 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate.

Molecular Properties

Compound Nameethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate
PubChem CID62394136
Molecular FormulaC12H18F2O3
Molecular Weight248.27 g/mol
Exact Mass248.12
IUPAC Nameethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate
SMILESCCOC(=O)C(F)(F)C(=O)C1CCC(C)CC1
InChIInChI=1S/C12H18F2O3/c1-3-17-11(16)12(13,14)10(15)9-6-4-8(2)5-7-9/h8-9H,3-7H2,1-2H3
InChIKeyLAJLCNXTMJJXLQ-UHFFFAOYSA-N
XLogP2.58
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.27
LogP ≤ 52.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate?
The IUPAC name of ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate (CID 62394136) is ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate.
What is the SMILES notation for ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate?
The canonical SMILES for ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate is CCOC(=O)C(F)(F)C(=O)C1CCC(C)CC1.
What is the InChIKey of ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate?
The InChIKey is LAJLCNXTMJJXLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2O3/c1-3-17-11(16)12(13,14)10(15)9-6-4-8(2)5-7-9/h8-9H,3-7H2,1-2H3.
What are the key properties of ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate?
ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate has a molecular weight of 248.27 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-difluoro-3-(4-methylcyclohexyl)-3-oxopropanoate is sourced from PubChem (CID 62394136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).