C12H18F2O3S — CID 65144261
ethyl 4-cyclohexylsulfanyl-2,2-difluoro-3-oxobutanoate (PubChem CID 65144261) has the molecular formula C12H18F2O3S and a molecular weight of 280.34 g/mol. Its IUPAC name is ethyl 4-cyclohexylsulfanyl-2,2-difluoro-3-oxobutanoate.
| Compound Name | ethyl 4-cyclohexylsulfanyl-2,2-difluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 65144261 |
| Molecular Formula | C12H18F2O3S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl 4-cyclohexylsulfanyl-2,2-difluoro-3-oxobutanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)CSC1CCCCC1 |
| InChI | InChI=1S/C12H18F2O3S/c1-2-17-11(16)12(13,14)10(15)8-18-9-6-4-3-5-7-9/h9H,2-8H2,1H3 |
| InChIKey | HMNTVGUFLKTTDD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|