C13H14F2O3S — CID 66097819
ethyl 2,2-difluoro-4-(2-methylphenyl)sulfanyl-3-oxobutanoate (PubChem CID 66097819) has the molecular formula C13H14F2O3S and a molecular weight of 288.32 g/mol. Its IUPAC name is ethyl 2,2-difluoro-4-(2-methylphenyl)sulfanyl-3-oxobutanoate.
| Compound Name | ethyl 2,2-difluoro-4-(2-methylphenyl)sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 66097819 |
| Molecular Formula | C13H14F2O3S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | ethyl 2,2-difluoro-4-(2-methylphenyl)sulfanyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)CSc1ccccc1C |
| InChI | InChI=1S/C13H14F2O3S/c1-3-18-12(17)13(14,15)11(16)8-19-10-7-5-4-6-9(10)2/h4-7H,3,8H2,1-2H3 |
| InChIKey | WIKLGAVQYFHDGS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|