C11H11F2NO3 — CID 62551421
ethyl 2,2-difluoro-3-oxo-4-pyridin-4-ylbutanoate (PubChem CID 62551421) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-oxo-4-pyridin-4-ylbutanoate.
| Compound Name | ethyl 2,2-difluoro-3-oxo-4-pyridin-4-ylbutanoate |
|---|---|
| PubChem CID | 62551421 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | ethyl 2,2-difluoro-3-oxo-4-pyridin-4-ylbutanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)Cc1ccncc1 |
| InChI | InChI=1S/C11H11F2NO3/c1-2-17-10(16)11(12,13)9(15)7-8-3-5-14-6-4-8/h3-6H,2,7H2,1H3 |
| InChIKey | RXWPDZMWUVLSPB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|