C17H16F2O2S — CID 59639402
ethyl 2-benzhydrylsulfanyl-2,2-difluoroacetate (PubChem CID 59639402) has the molecular formula C17H16F2O2S and a molecular weight of 322.38 g/mol. Its IUPAC name is ethyl 2-benzhydrylsulfanyl-2,2-difluoroacetate.
| Compound Name | ethyl 2-benzhydrylsulfanyl-2,2-difluoroacetate |
|---|---|
| PubChem CID | 59639402 |
| Molecular Formula | C17H16F2O2S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | ethyl 2-benzhydrylsulfanyl-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)SC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16F2O2S/c1-2-21-16(20)17(18,19)22-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,2H2,1H3 |
| InChIKey | KIIBGTLSYSHRHR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |