C18H19NO4 — CID 132609228
ethyl 2-methyl-2-nitro-3,3-diphenylpropanoate (PubChem CID 132609228) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl 2-methyl-2-nitro-3,3-diphenylpropanoate.
| Compound Name | ethyl 2-methyl-2-nitro-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 132609228 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl 2-methyl-2-nitro-3,3-diphenylpropanoate |
| SMILES | CCOC(=O)C(C)(C(c1ccccc1)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C18H19NO4/c1-3-23-17(20)18(2,19(21)22)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16H,3H2,1-2H3 |
| InChIKey | WNYMTFJFGDYJJS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|