C28H36BrKO5 — CID 101466425
potassium 4-(2-bromo-3-ethoxy-2-ethoxycarbonyl-3-oxo-1-phenylpropyl)-2,6-ditert-butylphenolate (PubChem CID 101466425) has the molecular formula C28H36BrKO5 and a molecular weight of 571.59 g/mol. Its IUPAC name is potassium 4-(2-bromo-3-ethoxy-2-ethoxycarbonyl-3-oxo-1-phenylpropyl)-2,6-ditert-butylphenolate.
| Compound Name | potassium 4-(2-bromo-3-ethoxy-2-ethoxycarbonyl-3-oxo-1-phenylpropyl)-2,6-ditert-butylphenolate |
|---|---|
| PubChem CID | 101466425 |
| Molecular Formula | C28H36BrKO5 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | potassium 4-(2-bromo-3-ethoxy-2-ethoxycarbonyl-3-oxo-1-phenylpropyl)-2,6-ditert-butylphenolate |
| SMILES | CCOC(=O)C(Br)(C(=O)OCC)C(c1ccccc1)c1cc(C(C)(C)C)c([O-])c(C(C)(C)C)c1.[K+] |
| InChI | InChI=1S/C28H37BrO5.K/c1-9-33-24(31)28(29,25(32)34-10-2)22(18-14-12-11-13-15-18)19-16-20(26(3,4)5)23(30)21(17-19)27(6,7)8;/h11-17,22,30H,9-10H2,1-8H3;/q;+1/p-1 |
| InChIKey | SVRUYKPCDHPROS-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|