C18H20O3 — CID 115590588
2-ethoxy-2-methyl-3,3-diphenylpropanoic acid (PubChem CID 115590588) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-ethoxy-2-methyl-3,3-diphenylpropanoic acid.
| Compound Name | 2-ethoxy-2-methyl-3,3-diphenylpropanoic acid |
|---|---|
| PubChem CID | 115590588 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-ethoxy-2-methyl-3,3-diphenylpropanoic acid |
| SMILES | CCOC(C)(C(=O)O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-3-21-18(2,17(19)20)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16H,3H2,1-2H3,(H,19,20) |
| InChIKey | FHWLFTMCJBOBBX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |