C17H20O — CID 15315706
2,2-dimethyl-3,3-diphenylpropan-1-ol (PubChem CID 15315706) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 2,2-dimethyl-3,3-diphenylpropan-1-ol.
| Compound Name | 2,2-dimethyl-3,3-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 15315706 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2,2-dimethyl-3,3-diphenylpropan-1-ol |
| SMILES | CC(C)(CO)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O/c1-17(2,13-18)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16,18H,13H2,1-2H3 |
| InChIKey | FNKXKCFPGVVRFJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |