C15H23NO5 — CID 159816827
2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-phenylpropanoic acid (PubChem CID 159816827) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-phenylpropanoic acid.
| Compound Name | 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-phenylpropanoic acid |
|---|---|
| PubChem CID | 159816827 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;2-phenylpropanoic acid |
| SMILES | CC(C(=O)O)c1ccccc1.CC(C)(CO)C(N)C(=O)O |
| InChI | InChI=1S/C9H10O2.C6H13NO3/c1-7(9(10)11)8-5-3-2-4-6-8;1-6(2,3-8)4(7)5(9)10/h2-7H,1H3,(H,10,11);4,8H,3,7H2,1-2H3,(H,9,10) |
| InChIKey | NLSHUBFSCOYWFR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |