C15H25NO6 — CID 174393301
2-amino-4-hydroxy-3,3-dimethylbutanoic acid;phenol;propanoic acid (PubChem CID 174393301) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;phenol;propanoic acid.
| Compound Name | 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;phenol;propanoic acid |
|---|---|
| PubChem CID | 174393301 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-amino-4-hydroxy-3,3-dimethylbutanoic acid;phenol;propanoic acid |
| SMILES | CC(C)(CO)C(N)C(=O)O.CCC(=O)O.Oc1ccccc1 |
| InChI | InChI=1S/C6H13NO3.C6H6O.C3H6O2/c1-6(2,3-8)4(7)5(9)10;7-6-4-2-1-3-5-6;1-2-3(4)5/h4,8H,3,7H2,1-2H3,(H,9,10);1-5,7H;2H2,1H3,(H,4,5) |
| InChIKey | LZHKTOGFLJHKRG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |