C16H25NO3 — CID 175310524
(3-hydroxy-2,2-dimethyl-1-phenylpropyl) N-tert-butylcarbamate (PubChem CID 175310524) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethyl-1-phenylpropyl) N-tert-butylcarbamate.
| Compound Name | (3-hydroxy-2,2-dimethyl-1-phenylpropyl) N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175310524 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (3-hydroxy-2,2-dimethyl-1-phenylpropyl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(c1ccccc1)C(C)(C)CO |
| InChI | InChI=1S/C16H25NO3/c1-15(2,3)17-14(19)20-13(16(4,5)11-18)12-9-7-6-8-10-12/h6-10,13,18H,11H2,1-5H3,(H,17,19) |
| InChIKey | WCQICIRIFFJXFJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |