C24H30ClNO4 — CID 167455657
[(1R)-2-(3-chlorophenyl)-2-methyl-1-phenylpropyl] N-[(2R)-2-formyl-1-hydroxyhexan-2-yl]carbamate (PubChem CID 167455657) has the molecular formula C24H30ClNO4 and a molecular weight of 431.96 g/mol. Its IUPAC name is [(1R)-2-(3-chlorophenyl)-2-methyl-1-phenylpropyl] N-[(2R)-2-formyl-1-hydroxyhexan-2-yl]carbamate.
| Compound Name | [(1R)-2-(3-chlorophenyl)-2-methyl-1-phenylpropyl] N-[(2R)-2-formyl-1-hydroxyhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 167455657 |
| Molecular Formula | C24H30ClNO4 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [(1R)-2-(3-chlorophenyl)-2-methyl-1-phenylpropyl] N-[(2R)-2-formyl-1-hydroxyhexan-2-yl]carbamate |
| SMILES | CCCC[C@](C=O)(CO)NC(=O)O[C@H](c1ccccc1)C(C)(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H30ClNO4/c1-4-5-14-24(16-27,17-28)26-22(29)30-21(18-10-7-6-8-11-18)23(2,3)19-12-9-13-20(25)15-19/h6-13,15-16,21,28H,4-5,14,17H2,1-3H3,(H,26,29)/t21-,24+/m1/s1 |
| InChIKey | JSNHGVMSZNYUIY-QPPBQGQZSA-N |
| XLogP | 5.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|