C34H45ClN4O6 — CID 175380102
[2-(3-chlorophenyl)-2-methyl-1-phenylpropyl] N-[(2S)-1-[[(2S)-4-(cyclopropylamino)-3-hydroxy-4-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]-1-oxohexan-2-yl]carbamate (PubChem CID 175380102) has the molecular formula C34H45ClN4O6 and a molecular weight of 641.21 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-methyl-1-phenylpropyl] N-[(2S)-1-[[(2S)-4-(cyclopropylamino)-3-hydroxy-4-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | [2-(3-chlorophenyl)-2-methyl-1-phenylpropyl] N-[(2S)-1-[[(2S)-4-(cyclopropylamino)-3-hydroxy-4-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 175380102 |
| Molecular Formula | C34H45ClN4O6 |
| Molecular Weight | 641.21 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | [2-(3-chlorophenyl)-2-methyl-1-phenylpropyl] N-[(2S)-1-[[(2S)-4-(cyclopropylamino)-3-hydroxy-4-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]-1-oxohexan-2-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OC(c1ccccc1)C(C)(C)c1cccc(Cl)c1)C(=O)N[C@@H](CC1CCNC1=O)C(O)C(=O)NC1CC1 |
| InChI | InChI=1S/C34H45ClN4O6/c1-4-5-14-26(31(42)38-27(19-22-17-18-36-30(22)41)28(40)32(43)37-25-15-16-25)39-33(44)45-29(21-10-7-6-8-11-21)34(2,3)23-12-9-13-24(35)20-23/h6-13,20,22,25-29,40H,4-5,14-19H2,1-3H3,(H,36,41)(H,37,43)(H,38,42)(H,39,44)/t22?,26-,27-,28?,29?/m0/s1 |
| InChIKey | LEQKKLQNHYPWMD-RLJJJZNVSA-N |
| XLogP | 4.29 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |