C34H44ClN3O5 — CID 156883744
[2-(3-chlorophenyl)-2-methyl-1-(3-methylphenyl)propyl] N-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]carbamate (PubChem CID 156883744) has the molecular formula C34H44ClN3O5 and a molecular weight of 610.20 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-methyl-1-(3-methylphenyl)propyl] N-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]carbamate.
| Compound Name | [2-(3-chlorophenyl)-2-methyl-1-(3-methylphenyl)propyl] N-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 156883744 |
| Molecular Formula | C34H44ClN3O5 |
| Molecular Weight | 610.20 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | [2-(3-chlorophenyl)-2-methyl-1-(3-methylphenyl)propyl] N-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]carbamate |
| SMILES | Cc1cccc(C(OC(=O)N[C@@H](CC2CCCCC2)C(=O)N[C@H](C=O)C[C@@H]2CCNC2=O)C(C)(C)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C34H44ClN3O5/c1-22-9-7-12-24(17-22)30(34(2,3)26-13-8-14-27(35)20-26)43-33(42)38-29(18-23-10-5-4-6-11-23)32(41)37-28(21-39)19-25-15-16-36-31(25)40/h7-9,12-14,17,20-21,23,25,28-30H,4-6,10-11,15-16,18-19H2,1-3H3,(H,36,40)(H,37,41)(H,38,42)/t25-,28-,29-,30?/m0/s1 |
| InChIKey | GDNRYSZLCXXMEZ-UNWVKDMGSA-N |
| XLogP | 5.94 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.20 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|