C21H35NO4 — CID 170640575
[(1R)-2-hydroxy-2-methyl-1-[4-[(2R)-2-methylpentoxy]phenyl]propyl] N-tert-butylcarbamate (PubChem CID 170640575) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is [(1R)-2-hydroxy-2-methyl-1-[4-[(2R)-2-methylpentoxy]phenyl]propyl] N-tert-butylcarbamate.
| Compound Name | [(1R)-2-hydroxy-2-methyl-1-[4-[(2R)-2-methylpentoxy]phenyl]propyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 170640575 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | [(1R)-2-hydroxy-2-methyl-1-[4-[(2R)-2-methylpentoxy]phenyl]propyl] N-tert-butylcarbamate |
| SMILES | CCC[C@@H](C)COc1ccc([C@@H](OC(=O)NC(C)(C)C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C21H35NO4/c1-8-9-15(2)14-25-17-12-10-16(11-13-17)18(21(6,7)24)26-19(23)22-20(3,4)5/h10-13,15,18,24H,8-9,14H2,1-7H3,(H,22,23)/t15-,18-/m1/s1 |
| InChIKey | NZXANTZGSPOUEJ-CRAIPNDOSA-N |
| XLogP | 4.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |