About N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate
N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate (PubChem CID 169109476) has the molecular formula C24H33NO4
and a molecular weight of 399.53 g/mol. Its IUPAC name is N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate.
Molecular Properties
| Compound Name | N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate |
| PubChem CID | 169109476 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate |
| SMILES | CCCC(C)COc1ccc(C(C)C(=O)OC)cc1.O=CNCc1ccccc1 |
| InChI | InChI=1S/C16H24O3.C8H9NO/c1-5-6-12(2)11-19-15-9-7-14(8-10-15)13(3)16(17)18-4;10-7-9-6-8-4-2-1-3-5-8/h7-10,12-13H,5-6,11H2,1-4H3;1-5,7H,6H2,(H,9,10) |
| InChIKey | DLEXOUMGYXXGCF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate?
The IUPAC name of N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate (CID 169109476) is N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate.
What is the SMILES notation for N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate?
The canonical SMILES for N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate is CCCC(C)COc1ccc(C(C)C(=O)OC)cc1.O=CNCc1ccccc1.
What is the InChIKey of N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate?
The InChIKey is DLEXOUMGYXXGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3.C8H9NO/c1-5-6-12(2)11-19-15-9-7-14(8-10-15)13(3)16(17)18-4;10-7-9-6-8-4-2-1-3-5-8/h7-10,12-13H,5-6,11H2,1-4H3;1-5,7H,6H2,(H,9,10).
What are the key properties of N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate?
N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate has a molecular weight of 399.53 g/mol, XLogP of 4.71, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylformamide;methyl 2-[4-(2-methylpentoxy)phenyl]propanoate is sourced from PubChem (CID 169109476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).