C23H28FNO4 — CID 134130479
methyl (2R)-2-[[2-(3-fluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate (PubChem CID 134130479) has the molecular formula C23H28FNO4 and a molecular weight of 401.48 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(3-fluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate.
| Compound Name | methyl (2R)-2-[[2-(3-fluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate |
|---|---|
| PubChem CID | 134130479 |
| Molecular Formula | C23H28FNO4 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | methyl (2R)-2-[[2-(3-fluorophenyl)acetyl]amino]-2-[4-(2-methylpentoxy)phenyl]acetate |
| SMILES | CCCC(C)COc1ccc([C@@H](NC(=O)Cc2cccc(F)c2)C(=O)OC)cc1 |
| InChI | InChI=1S/C23H28FNO4/c1-4-6-16(2)15-29-20-11-9-18(10-12-20)22(23(27)28-3)25-21(26)14-17-7-5-8-19(24)13-17/h5,7-13,16,22H,4,6,14-15H2,1-3H3,(H,25,26)/t16?,22-/m1/s1 |
| InChIKey | UXYYWGJVRZWIQM-VXNXSFHZSA-N |
| XLogP | 4.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |