C23H25N3O3 — CID 177445632
[(2R)-1-oxo-3-phenyl-1-(quinolin-3-ylamino)propan-2-yl] N-tert-butylcarbamate (PubChem CID 177445632) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is [(2R)-1-oxo-3-phenyl-1-(quinolin-3-ylamino)propan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2R)-1-oxo-3-phenyl-1-(quinolin-3-ylamino)propan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 177445632 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | [(2R)-1-oxo-3-phenyl-1-(quinolin-3-ylamino)propan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H](Cc1ccccc1)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C23H25N3O3/c1-23(2,3)26-22(28)29-20(13-16-9-5-4-6-10-16)21(27)25-18-14-17-11-7-8-12-19(17)24-15-18/h4-12,14-15,20H,13H2,1-3H3,(H,25,27)(H,26,28)/t20-/m1/s1 |
| InChIKey | UUJUYBNVEPPGSK-HXUWFJFHSA-N |
| XLogP | 4.31 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |