C24H29N5O2 — CID 10002169
(2S)-5-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]-methylamino]-N-quinolin-3-ylpentanamide (PubChem CID 10002169) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]-methylamino]-N-quinolin-3-ylpentanamide.
| Compound Name | (2S)-5-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]-methylamino]-N-quinolin-3-ylpentanamide |
|---|---|
| PubChem CID | 10002169 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]-methylamino]-N-quinolin-3-ylpentanamide |
| SMILES | CN(C(=O)[C@@H](N)Cc1ccccc1)[C@@H](CCCN)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C24H29N5O2/c1-29(24(31)20(26)14-17-8-3-2-4-9-17)22(12-7-13-25)23(30)28-19-15-18-10-5-6-11-21(18)27-16-19/h2-6,8-11,15-16,20,22H,7,12-14,25-26H2,1H3,(H,28,30)/t20-,22-/m0/s1 |
| InChIKey | BTYXZFVYKJCXAL-UNMCSNQZSA-N |
| XLogP | 2.31 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |