C25H27N3O4 — CID 69322143
[(2S)-1,8-dioxo-1-(quinolin-3-ylamino)nonan-2-yl]-phenylcarbamic acid (PubChem CID 69322143) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is [(2S)-1,8-dioxo-1-(quinolin-3-ylamino)nonan-2-yl]-phenylcarbamic acid.
| Compound Name | [(2S)-1,8-dioxo-1-(quinolin-3-ylamino)nonan-2-yl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 69322143 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [(2S)-1,8-dioxo-1-(quinolin-3-ylamino)nonan-2-yl]-phenylcarbamic acid |
| SMILES | CC(=O)CCCCC[C@@H](C(=O)Nc1cnc2ccccc2c1)N(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O4/c1-18(29)10-4-2-7-15-23(28(25(31)32)21-12-5-3-6-13-21)24(30)27-20-16-19-11-8-9-14-22(19)26-17-20/h3,5-6,8-9,11-14,16-17,23H,2,4,7,10,15H2,1H3,(H,27,30)(H,31,32)/t23-/m0/s1 |
| InChIKey | NOEWRNROVUGPOU-QHCPKHFHSA-N |
| XLogP | 5.27 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|