C26H36N4O4 — CID 69319642
[(2S)-1,8-dioxo-1-(quinolin-3-ylamino)nonan-2-yl]-(2-piperidin-1-ylethyl)carbamic acid (PubChem CID 69319642) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is [(2S)-1,8-dioxo-1-(quinolin-3-ylamino)nonan-2-yl]-(2-piperidin-1-ylethyl)carbamic acid.
| Compound Name | [(2S)-1,8-dioxo-1-(quinolin-3-ylamino)nonan-2-yl]-(2-piperidin-1-ylethyl)carbamic acid |
|---|---|
| PubChem CID | 69319642 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [(2S)-1,8-dioxo-1-(quinolin-3-ylamino)nonan-2-yl]-(2-piperidin-1-ylethyl)carbamic acid |
| SMILES | CC(=O)CCCCC[C@@H](C(=O)Nc1cnc2ccccc2c1)N(CCN1CCCCC1)C(=O)O |
| InChI | InChI=1S/C26H36N4O4/c1-20(31)10-4-2-5-13-24(30(26(33)34)17-16-29-14-8-3-9-15-29)25(32)28-22-18-21-11-6-7-12-23(21)27-19-22/h6-7,11-12,18-19,24H,2-5,8-10,13-17H2,1H3,(H,28,32)(H,33,34)/t24-/m0/s1 |
| InChIKey | XTKDDKMEXPRPHI-DEOSSOPVSA-N |
| XLogP | 4.55 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|