C25H27N5O — CID 162787940
5-[4-(3-cyanophenyl)piperazin-1-yl]-N-quinolin-3-ylpentanamide (PubChem CID 162787940) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is 5-[4-(3-cyanophenyl)piperazin-1-yl]-N-quinolin-3-ylpentanamide.
| Compound Name | 5-[4-(3-cyanophenyl)piperazin-1-yl]-N-quinolin-3-ylpentanamide |
|---|---|
| PubChem CID | 162787940 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 5-[4-(3-cyanophenyl)piperazin-1-yl]-N-quinolin-3-ylpentanamide |
| SMILES | N#Cc1cccc(N2CCN(CCCCC(=O)Nc3cnc4ccccc4c3)CC2)c1 |
| InChI | InChI=1S/C25H27N5O/c26-18-20-6-5-8-23(16-20)30-14-12-29(13-15-30)11-4-3-10-25(31)28-22-17-21-7-1-2-9-24(21)27-19-22/h1-2,5-9,16-17,19H,3-4,10-15H2,(H,28,31) |
| InChIKey | DDCLBQAQKIXUSM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|