C23H25F3N4OS — CID 122186392
N-(1,3-benzothiazol-2-yl)-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentanamide (PubChem CID 122186392) has the molecular formula C23H25F3N4OS and a molecular weight of 462.54 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentanamide |
|---|---|
| PubChem CID | 122186392 |
| Molecular Formula | C23H25F3N4OS |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pentanamide |
| SMILES | O=C(CCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H25F3N4OS/c24-23(25,26)17-6-5-7-18(16-17)30-14-12-29(13-15-30)11-4-3-10-21(31)28-22-27-19-8-1-2-9-20(19)32-22/h1-2,5-9,16H,3-4,10-15H2,(H,27,28,31) |
| InChIKey | DCCXPUKZFPQJAB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|