C21H18F3N3OS — CID 9154199
(E)-3-(1,3-benzothiazol-2-yl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 9154199) has the molecular formula C21H18F3N3OS and a molecular weight of 417.46 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9154199 |
| Molecular Formula | C21H18F3N3OS |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H18F3N3OS/c22-21(23,24)15-4-3-5-16(14-15)26-10-12-27(13-11-26)20(28)9-8-19-25-17-6-1-2-7-18(17)29-19/h1-9,14H,10-13H2/b9-8+ |
| InChIKey | UEZLVEMHJPMXPU-CMDGGOBGSA-N |
| XLogP | 4.68 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|