C14H14N2OS — CID 76857549
3-(1,3-benzothiazol-2-yl)-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 76857549) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 76857549 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1nc2ccccc2s1)N1CCCC1 |
| InChI | InChI=1S/C14H14N2OS/c17-14(16-9-3-4-10-16)8-7-13-15-11-5-1-2-6-12(11)18-13/h1-2,5-8H,3-4,9-10H2 |
| InChIKey | WEDNZLNMXMYWBF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|