C20H23N3O2S — CID 131937065
9-[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoyl]-2-methyl-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 131937065) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 9-[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoyl]-2-methyl-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoyl]-2-methyl-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 131937065 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 9-[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoyl]-2-methyl-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | CN1CC2(CCC1=O)CCN(C(=O)/C=C/c1nc3ccccc3s1)CC2 |
| InChI | InChI=1S/C20H23N3O2S/c1-22-14-20(9-8-18(22)24)10-12-23(13-11-20)19(25)7-6-17-21-15-4-2-3-5-16(15)26-17/h2-7H,8-14H2,1H3/b7-6+ |
| InChIKey | RTDPDLJVPDVYTF-VOTSOKGWSA-N |
| XLogP | 3.17 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|