C19H18N4OS — CID 7478667
(E)-3-(1,3-benzothiazol-2-yl)-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 7478667) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7478667 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H18N4OS/c24-19(9-8-18-21-15-5-1-2-6-16(15)25-18)23-13-11-22(12-14-23)17-7-3-4-10-20-17/h1-10H,11-14H2/b9-8+ |
| InChIKey | IRNFHASZDBPHGW-CMDGGOBGSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|