C19H20N6OS — CID 131916772
(E)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3-(1,3-benzothiazol-2-yl)prop-2-en-1-one (PubChem CID 131916772) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is (E)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3-(1,3-benzothiazol-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3-(1,3-benzothiazol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 131916772 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (E)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3-(1,3-benzothiazol-2-yl)prop-2-en-1-one |
| SMILES | Cc1cc(N2CCN(C(=O)/C=C/c3nc4ccccc4s3)CC2)nc(N)n1 |
| InChI | InChI=1S/C19H20N6OS/c1-13-12-16(23-19(20)21-13)24-8-10-25(11-9-24)18(26)7-6-17-22-14-4-2-3-5-15(14)27-17/h2-7,12H,8-11H2,1H3,(H2,20,21,23)/b7-6+ |
| InChIKey | XIDYMCIHOFVURH-VOTSOKGWSA-N |
| XLogP | 2.34 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|