C17H14N2OS2 — CID 17473489
(E)-3-(1,3-benzothiazol-2-yl)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one (PubChem CID 17473489) has the molecular formula C17H14N2OS2 and a molecular weight of 326.45 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 17473489 |
| Molecular Formula | C17H14N2OS2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C17H14N2OS2/c20-17(19-9-7-14-12(11-19)8-10-21-14)6-5-16-18-13-3-1-2-4-15(13)22-16/h1-6,8,10H,7,9,11H2/b6-5+ |
| InChIKey | GNFZOKLHRZJHIU-AATRIKPKSA-N |
| XLogP | 3.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|