C18H19N3O2S — CID 9389766
(E)-3-(1,3-benzothiazol-2-yl)-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 9389766) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9389766 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-1-[4-(cyclopropanecarbonyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C18H19N3O2S/c22-17(8-7-16-19-14-3-1-2-4-15(14)24-16)20-9-11-21(12-10-20)18(23)13-5-6-13/h1-4,7-8,13H,5-6,9-12H2/b8-7+ |
| InChIKey | LLMJTQYBXQHIFA-BQYQJAHWSA-N |
| XLogP | 2.39 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|