C22H20N2O2S — CID 123472255
3-(1,3-benzothiazol-2-yl)-1-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylprop-2-en-1-one (PubChem CID 123472255) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylprop-2-en-1-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 123472255 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1nc2ccccc2s1)N1CCC2(CC1)OCc1ccccc12 |
| InChI | InChI=1S/C22H20N2O2S/c25-21(10-9-20-23-18-7-3-4-8-19(18)27-20)24-13-11-22(12-14-24)17-6-2-1-5-16(17)15-26-22/h1-10H,11-15H2 |
| InChIKey | CPAPDWSQWQPYOR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|