C21H24N4O4S — CID 171149699
3-(1,3-benzothiazol-2-yl)-1-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]prop-2-en-1-one;formic acid (PubChem CID 171149699) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]prop-2-en-1-one;formic acid.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]prop-2-en-1-one;formic acid |
|---|---|
| PubChem CID | 171149699 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]prop-2-en-1-one;formic acid |
| SMILES | Cn1ccnc1C(O)C1CCN(C(=O)C=Cc2nc3ccccc3s2)CC1.O=CO |
| InChI | InChI=1S/C20H22N4O2S.CH2O2/c1-23-13-10-21-20(23)19(26)14-8-11-24(12-9-14)18(25)7-6-17-22-15-4-2-3-5-16(15)27-17;2-1-3/h2-7,10,13-14,19,26H,8-9,11-12H2,1H3;1H,(H,2,3) |
| InChIKey | JVOYFCCQLJGDHL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|