C22H29N3O3 — CID 132970323
(E)-1-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]-4-(2-methoxyphenyl)-3-methylbut-2-en-1-one (PubChem CID 132970323) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is (E)-1-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]-4-(2-methoxyphenyl)-3-methylbut-2-en-1-one.
| Compound Name | (E)-1-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]-4-(2-methoxyphenyl)-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 132970323 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (E)-1-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]-4-(2-methoxyphenyl)-3-methylbut-2-en-1-one |
| SMILES | COc1ccccc1C/C(C)=C/C(=O)N1CCC(C(O)c2nccn2C)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-16(14-18-6-4-5-7-19(18)28-3)15-20(26)25-11-8-17(9-12-25)21(27)22-23-10-13-24(22)2/h4-7,10,13,15,17,21,27H,8-9,11-12,14H2,1-3H3/b16-15+ |
| InChIKey | GVCJRGDWBQQVLO-FOCLMDBBSA-N |
| XLogP | 2.89 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|