C17H22ClNO4 — CID 126770838
1-[4-(2-methoxyphenyl)-3-methylbut-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 126770838) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)-3-methylbut-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[4-(2-methoxyphenyl)-3-methylbut-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 126770838 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)-3-methylbut-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | COc1ccccc1CC(C)=CC(=O)N1CCC(C(=O)O)C1.Cl |
| InChI | InChI=1S/C17H21NO4.ClH/c1-12(9-13-5-3-4-6-15(13)22-2)10-16(19)18-8-7-14(11-18)17(20)21;/h3-6,10,14H,7-9,11H2,1-2H3,(H,20,21);1H |
| InChIKey | IFAMHWSKUQEGJQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|