C14H15F2NO4 — CID 119354951
1-[2-[2-(difluoromethoxy)phenyl]acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 119354951) has the molecular formula C14H15F2NO4 and a molecular weight of 299.27 g/mol. Its IUPAC name is 1-[2-[2-(difluoromethoxy)phenyl]acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[2-(difluoromethoxy)phenyl]acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119354951 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[2-[2-(difluoromethoxy)phenyl]acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)Cc2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C14H15F2NO4/c15-14(16)21-11-4-2-1-3-9(11)7-12(18)17-6-5-10(8-17)13(19)20/h1-4,10,14H,5-8H2,(H,19,20) |
| InChIKey | GWUHQCCBXHKGAE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |