C14H17F2NO3 — CID 43440909
1-[[2-(difluoromethoxy)phenyl]methyl]piperidine-3-carboxylic acid (PubChem CID 43440909) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 43440909 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(Cc2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C14H17F2NO3/c15-14(16)20-12-6-2-1-4-10(12)8-17-7-3-5-11(9-17)13(18)19/h1-2,4,6,11,14H,3,5,7-9H2,(H,18,19) |
| InChIKey | KYVNYVYRTVBICC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |