C20H24N2O3 — CID 98184686
(E,2S)-2-cyano-N-cyclopentyl-6-(2-methoxyphenyl)-5-methyl-3-oxohex-4-enamide (PubChem CID 98184686) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (E,2S)-2-cyano-N-cyclopentyl-6-(2-methoxyphenyl)-5-methyl-3-oxohex-4-enamide.
| Compound Name | (E,2S)-2-cyano-N-cyclopentyl-6-(2-methoxyphenyl)-5-methyl-3-oxohex-4-enamide |
|---|---|
| PubChem CID | 98184686 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (E,2S)-2-cyano-N-cyclopentyl-6-(2-methoxyphenyl)-5-methyl-3-oxohex-4-enamide |
| SMILES | COc1ccccc1C/C(C)=C/C(=O)[C@H](C#N)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H24N2O3/c1-14(11-15-7-3-6-10-19(15)25-2)12-18(23)17(13-21)20(24)22-16-8-4-5-9-16/h3,6-7,10,12,16-17H,4-5,8-9,11H2,1-2H3,(H,22,24)/b14-12+/t17-/m0/s1 |
| InChIKey | DATDJLLETAOESD-VSOYFRJCSA-N |
| XLogP | 2.95 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|