C14H16N2S — CID 154110849
2-(2-piperidin-1-ylethenyl)-1,3-benzothiazole (PubChem CID 154110849) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethenyl)-1,3-benzothiazole.
| Compound Name | 2-(2-piperidin-1-ylethenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 154110849 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(2-piperidin-1-ylethenyl)-1,3-benzothiazole |
| SMILES | C(=CN1CCCCC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H16N2S/c1-4-9-16(10-5-1)11-8-14-15-12-6-2-3-7-13(12)17-14/h2-3,6-8,11H,1,4-5,9-10H2 |
| InChIKey | AJXBSEOMJGIQCO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |