C19H25N3OS — CID 76858411
N-[3-(azepan-1-yl)propyl]-3-(1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 76858411) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-3-(1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-3-(1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76858411 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-3-(1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1nc2ccccc2s1)NCCCN1CCCCCC1 |
| InChI | InChI=1S/C19H25N3OS/c23-18(20-12-7-15-22-13-5-1-2-6-14-22)10-11-19-21-16-8-3-4-9-17(16)24-19/h3-4,8-11H,1-2,5-7,12-15H2,(H,20,23) |
| InChIKey | CRTHQLJZEJJJEF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|